C10H10N4S — CID 155482379
2-(1,3-thiazole-5-carboximidoyl)benzene-1,4-diamine (PubChem CID 155482379) has the molecular formula C10H10N4S and a molecular weight of 218.29 g/mol. Its IUPAC name is 2-(1,3-thiazole-5-carboximidoyl)benzene-1,4-diamine.
| Compound Name | 2-(1,3-thiazole-5-carboximidoyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 155482379 |
| Molecular Formula | C10H10N4S |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2-(1,3-thiazole-5-carboximidoyl)benzene-1,4-diamine |
| SMILES | [H]/N=C(\c1cncs1)c1cc(N)ccc1N |
| InChI | InChI=1S/C10H10N4S/c11-6-1-2-8(12)7(3-6)10(13)9-4-14-5-15-9/h1-5,13H,11-12H2/b13-10- |
| InChIKey | OBRZFHMPAKRFOO-RAXLEYEMSA-N |
| XLogP | 1.72 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|