C20H19N5O — CID 156850491
2,3-dihydro-1H-indene-5-carbonitrile;2-(1,2-oxazole-4-carboximidoyl)benzene-1,4-diamine (PubChem CID 156850491) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene-5-carbonitrile;2-(1,2-oxazole-4-carboximidoyl)benzene-1,4-diamine.
| Compound Name | 2,3-dihydro-1H-indene-5-carbonitrile;2-(1,2-oxazole-4-carboximidoyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 156850491 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2,3-dihydro-1H-indene-5-carbonitrile;2-(1,2-oxazole-4-carboximidoyl)benzene-1,4-diamine |
| SMILES | N#Cc1ccc2c(c1)CCC2.[H]/N=C(\c1cnoc1)c1cc(N)ccc1N |
| InChI | InChI=1S/C10H10N4O.C10H9N/c11-7-1-2-9(12)8(3-7)10(13)6-4-14-15-5-6;11-7-8-4-5-9-2-1-3-10(9)6-8/h1-5,13H,11-12H2;4-6H,1-3H2/b13-10+; |
| InChIKey | QXYCPFJOXCBJCV-RSGUCCNWSA-N |
| XLogP | 3.30 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|