C24H25N5O — CID 166551350
2-(2-methoxypyridine-4-carboximidoyl)benzene-1,4-diamine;5,6,7,8-tetrahydronaphthalene-2-carbonitrile (PubChem CID 166551350) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-(2-methoxypyridine-4-carboximidoyl)benzene-1,4-diamine;5,6,7,8-tetrahydronaphthalene-2-carbonitrile.
| Compound Name | 2-(2-methoxypyridine-4-carboximidoyl)benzene-1,4-diamine;5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 166551350 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-(2-methoxypyridine-4-carboximidoyl)benzene-1,4-diamine;5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CCCC2.[H]/N=C(\c1ccnc(OC)c1)c1cc(N)ccc1N |
| InChI | InChI=1S/C13H14N4O.C11H11N/c1-18-12-6-8(4-5-17-12)13(16)10-7-9(14)2-3-11(10)15;12-8-9-5-6-10-3-1-2-4-11(10)7-9/h2-7,16H,14-15H2,1H3;5-7H,1-4H2/b16-13+; |
| InChIKey | OHZDTMQVKZZBAG-ZUQRMPMESA-N |
| XLogP | 4.11 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|