C24H26N4 — CID 156850980
5-[4-amino-3-(cyclohexene-1-carboximidoyl)anilino]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile (PubChem CID 156850980) has the molecular formula C24H26N4 and a molecular weight of 370.50 g/mol. Its IUPAC name is 5-[4-amino-3-(cyclohexene-1-carboximidoyl)anilino]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile.
| Compound Name | 5-[4-amino-3-(cyclohexene-1-carboximidoyl)anilino]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 156850980 |
| Molecular Formula | C24H26N4 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 5-[4-amino-3-(cyclohexene-1-carboximidoyl)anilino]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
| SMILES | [H]/N=C(\C1=CCCCC1)c1cc(NC2CCCc3cc(C#N)ccc32)ccc1N |
| InChI | InChI=1S/C24H26N4/c25-15-16-9-11-20-18(13-16)7-4-8-23(20)28-19-10-12-22(26)21(14-19)24(27)17-5-2-1-3-6-17/h5,9-14,23,27-28H,1-4,6-8,26H2/b27-24+ |
| InChIKey | MOSWNWIUWXWJES-SOYKGTTHSA-N |
| XLogP | 5.50 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|