C21H17F3N6 — CID 156850917
1-[4-amino-3-[1-(difluoromethyl)pyrazole-4-carboximidoyl]anilino]-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile (PubChem CID 156850917) has the molecular formula C21H17F3N6 and a molecular weight of 410.40 g/mol. Its IUPAC name is 1-[4-amino-3-[1-(difluoromethyl)pyrazole-4-carboximidoyl]anilino]-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile.
| Compound Name | 1-[4-amino-3-[1-(difluoromethyl)pyrazole-4-carboximidoyl]anilino]-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile |
|---|---|
| PubChem CID | 156850917 |
| Molecular Formula | C21H17F3N6 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-[4-amino-3-[1-(difluoromethyl)pyrazole-4-carboximidoyl]anilino]-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile |
| SMILES | [H]/N=C(\c1cnn(C(F)F)c1)c1cc(NC2CCc3c2ccc(C#N)c3F)ccc1N |
| InChI | InChI=1S/C21H17F3N6/c22-19-11(8-25)1-3-14-15(19)4-6-18(14)29-13-2-5-17(26)16(7-13)20(27)12-9-28-30(10-12)21(23)24/h1-3,5,7,9-10,18,21,27,29H,4,6,26H2/b27-20+ |
| InChIKey | AYWRSZBNPVSSTA-NHFJDJAPSA-N |
| XLogP | 4.39 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|