C20H18N6S — CID 156851112
(8R)-8-[4-amino-3-(1,3-thiazole-5-carboximidoyl)anilino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 156851112) has the molecular formula C20H18N6S and a molecular weight of 374.47 g/mol. Its IUPAC name is (8R)-8-[4-amino-3-(1,3-thiazole-5-carboximidoyl)anilino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (8R)-8-[4-amino-3-(1,3-thiazole-5-carboximidoyl)anilino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 156851112 |
| Molecular Formula | C20H18N6S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (8R)-8-[4-amino-3-(1,3-thiazole-5-carboximidoyl)anilino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | [H]/N=C(\c1cncs1)c1cc(N[C@@H]2CCCc3cc(C#N)cnc32)ccc1N |
| InChI | InChI=1S/C20H18N6S/c21-8-12-6-13-2-1-3-17(20(13)25-9-12)26-14-4-5-16(22)15(7-14)19(23)18-10-24-11-27-18/h4-7,9-11,17,23,26H,1-3,22H2/b23-19-/t17-/m1/s1 |
| InChIKey | PKKLAARPRCXNEK-QIDKZVQTSA-N |
| XLogP | 3.90 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|