C22H22N6O — CID 156850731
8-[4-amino-3-(2-methyl-1,3-oxazole-5-carboximidoyl)anilino]-2-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 156850731) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is 8-[4-amino-3-(2-methyl-1,3-oxazole-5-carboximidoyl)anilino]-2-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 8-[4-amino-3-(2-methyl-1,3-oxazole-5-carboximidoyl)anilino]-2-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 156850731 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 8-[4-amino-3-(2-methyl-1,3-oxazole-5-carboximidoyl)anilino]-2-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | [H]/N=C(\c1cnc(C)o1)c1cc(NC2CCCc3cc(C#N)c(C)nc32)ccc1N |
| InChI | InChI=1S/C22H22N6O/c1-12-15(10-23)8-14-4-3-5-19(22(14)27-12)28-16-6-7-18(24)17(9-16)21(25)20-11-26-13(2)29-20/h6-9,11,19,25,28H,3-5,24H2,1-2H3/b25-21- |
| InChIKey | ZMIDNGNQRYOCMO-DAFNUICNSA-N |
| XLogP | 4.05 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|