C19H20N4 — CID 156850754
5-(4-amino-3-ethanimidoylanilino)-5,6,7,8-tetrahydronaphthalene-2-carbonitrile (PubChem CID 156850754) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is 5-(4-amino-3-ethanimidoylanilino)-5,6,7,8-tetrahydronaphthalene-2-carbonitrile.
| Compound Name | 5-(4-amino-3-ethanimidoylanilino)-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 156850754 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 5-(4-amino-3-ethanimidoylanilino)-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
| SMILES | [H]/N=C(\C)c1cc(NC2CCCc3cc(C#N)ccc32)ccc1N |
| InChI | InChI=1S/C19H20N4/c1-12(21)17-10-15(6-8-18(17)22)23-19-4-2-3-14-9-13(11-20)5-7-16(14)19/h5-10,19,21,23H,2-4,22H2,1H3/b21-12+ |
| InChIKey | LMDGEPSKNRHDII-CIAFOILYSA-N |
| XLogP | 4.02 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|