C18H18N4 — CID 166728056
1-(4-amino-3-ethanimidoylanilino)-2,3-dihydro-1H-indene-5-carbonitrile (PubChem CID 166728056) has the molecular formula C18H18N4 and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-(4-amino-3-ethanimidoylanilino)-2,3-dihydro-1H-indene-5-carbonitrile.
| Compound Name | 1-(4-amino-3-ethanimidoylanilino)-2,3-dihydro-1H-indene-5-carbonitrile |
|---|---|
| PubChem CID | 166728056 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-(4-amino-3-ethanimidoylanilino)-2,3-dihydro-1H-indene-5-carbonitrile |
| SMILES | [H]/N=C(\C)c1cc(NC2CCc3cc(C#N)ccc32)ccc1N |
| InChI | InChI=1S/C18H18N4/c1-11(20)16-9-14(4-6-17(16)21)22-18-7-3-13-8-12(10-19)2-5-15(13)18/h2,4-6,8-9,18,20,22H,3,7,21H2,1H3/b20-11+ |
| InChIKey | OBRXKFPMLVSHHO-RGVLZGJSSA-N |
| XLogP | 3.63 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|