C11H11N3 — CID 147563554
3,4-di(ethanimidoyl)benzonitrile (PubChem CID 147563554) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 3,4-di(ethanimidoyl)benzonitrile.
| Compound Name | 3,4-di(ethanimidoyl)benzonitrile |
|---|---|
| PubChem CID | 147563554 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 3,4-di(ethanimidoyl)benzonitrile |
| SMILES | [H]/N=C(\C)c1ccc(C#N)cc1/C(C)=N/[H] |
| InChI | InChI=1S/C11H11N3/c1-7(13)10-4-3-9(6-12)5-11(10)8(2)14/h3-5,13-14H,1-2H3/b13-7+,14-8+ |
| InChIKey | FTCLWOCHNWUHRX-FNCQTZNRSA-N |
| XLogP | 2.33 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|