C16H14ClN3 — CID 79079725
2-chloro-5-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzonitrile (PubChem CID 79079725) has the molecular formula C16H14ClN3 and a molecular weight of 283.76 g/mol. Its IUPAC name is 2-chloro-5-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzonitrile.
| Compound Name | 2-chloro-5-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzonitrile |
|---|---|
| PubChem CID | 79079725 |
| Molecular Formula | C16H14ClN3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-chloro-5-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzonitrile |
| SMILES | N#Cc1cc(NC2CCCc3cccnc32)ccc1Cl |
| InChI | InChI=1S/C16H14ClN3/c17-14-7-6-13(9-12(14)10-18)20-15-5-1-3-11-4-2-8-19-16(11)15/h2,4,6-9,15,20H,1,3,5H2 |
| InChIKey | QNDAXNQWJUQXIS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |