About 2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide
2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide (PubChem CID 102773264) has the molecular formula C15H14ClN3O
and a molecular weight of 287.75 g/mol. Its IUPAC name is 2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide.
Molecular Properties
| Compound Name | 2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide |
| PubChem CID | 102773264 |
| Molecular Formula | C15H14ClN3O |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide |
| SMILES | NC(=O)c1ccc(NC2CCc3cccnc32)cc1Cl |
| InChI | InChI=1S/C15H14ClN3O/c16-12-8-10(4-5-11(12)15(17)20)19-13-6-3-9-2-1-7-18-14(9)13/h1-2,4-5,7-8,13,19H,3,6H2,(H2,17,20) |
| InChIKey | PICRSRQDEIQDCT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide?
The IUPAC name of 2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide (CID 102773264) is 2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide.
What is the SMILES notation for 2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide?
The canonical SMILES for 2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide is NC(=O)c1ccc(NC2CCc3cccnc32)cc1Cl.
What is the InChIKey of 2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide?
The InChIKey is PICRSRQDEIQDCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClN3O/c16-12-8-10(4-5-11(12)15(17)20)19-13-6-3-9-2-1-7-18-14(9)13/h1-2,4-5,7-8,13,19H,3,6H2,(H2,17,20).
What are the key properties of 2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide?
2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide has a molecular weight of 287.75 g/mol, XLogP of 2.93, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylamino)benzamide is sourced from PubChem (CID 102773264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).