C20H16F3N5O — CID 156850621
2-(1,3-oxazole-5-carboximidoyl)benzene-1,4-diamine;2,2,4-trifluoro-1,3-dihydroindene-5-carbonitrile (PubChem CID 156850621) has the molecular formula C20H16F3N5O and a molecular weight of 399.38 g/mol. Its IUPAC name is 2-(1,3-oxazole-5-carboximidoyl)benzene-1,4-diamine;2,2,4-trifluoro-1,3-dihydroindene-5-carbonitrile.
| Compound Name | 2-(1,3-oxazole-5-carboximidoyl)benzene-1,4-diamine;2,2,4-trifluoro-1,3-dihydroindene-5-carbonitrile |
|---|---|
| PubChem CID | 156850621 |
| Molecular Formula | C20H16F3N5O |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-(1,3-oxazole-5-carboximidoyl)benzene-1,4-diamine;2,2,4-trifluoro-1,3-dihydroindene-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1F)CC(F)(F)C2.[H]/N=C(\c1cnco1)c1cc(N)ccc1N |
| InChI | InChI=1S/C10H6F3N.C10H10N4O/c11-9-7(5-14)2-1-6-3-10(12,13)4-8(6)9;11-6-1-2-8(12)7(3-6)10(13)9-4-14-5-15-9/h1-2H,3-4H2;1-5,13H,11-12H2/b;13-10- |
| InChIKey | QYEHKAFWHABHHZ-MUGUWCKXSA-N |
| XLogP | 3.69 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|