C21H19F2N6O+ — CID 155575003
[[2-amino-5-[(3-cyano-2,6-dimethylbenzoyl)amino]phenyl]-[1-(difluoromethyl)pyrazol-4-yl]methylidene]azanium (PubChem CID 155575003) has the molecular formula C21H19F2N6O+ and a molecular weight of 409.42 g/mol. Its IUPAC name is [[2-amino-5-[(3-cyano-2,6-dimethylbenzoyl)amino]phenyl]-[1-(difluoromethyl)pyrazol-4-yl]methylidene]azanium.
| Compound Name | [[2-amino-5-[(3-cyano-2,6-dimethylbenzoyl)amino]phenyl]-[1-(difluoromethyl)pyrazol-4-yl]methylidene]azanium |
|---|---|
| PubChem CID | 155575003 |
| Molecular Formula | C21H19F2N6O+ |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | [[2-amino-5-[(3-cyano-2,6-dimethylbenzoyl)amino]phenyl]-[1-(difluoromethyl)pyrazol-4-yl]methylidene]azanium |
| SMILES | Cc1ccc(C#N)c(C)c1C(=O)Nc1ccc(N)c(C(=[NH2+])c2cnn(C(F)F)c2)c1 |
| InChI | InChI=1S/C21H18F2N6O/c1-11-3-4-13(8-24)12(2)18(11)20(30)28-15-5-6-17(25)16(7-15)19(26)14-9-27-29(10-14)21(22)23/h3-7,9-10,21,26H,25H2,1-2H3,(H,28,30)/p+1 |
| InChIKey | HKIVLTNWEPQLQH-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|