C19H16F3N5O — CID 155574887
N-[4-amino-3-[(E)-4,4,4-trifluorobut-2-enimidoyl]phenyl]-5-cyano-3,4-dimethylpyridine-2-carboxamide (PubChem CID 155574887) has the molecular formula C19H16F3N5O and a molecular weight of 387.37 g/mol. Its IUPAC name is N-[4-amino-3-[(E)-4,4,4-trifluorobut-2-enimidoyl]phenyl]-5-cyano-3,4-dimethylpyridine-2-carboxamide.
| Compound Name | N-[4-amino-3-[(E)-4,4,4-trifluorobut-2-enimidoyl]phenyl]-5-cyano-3,4-dimethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 155574887 |
| Molecular Formula | C19H16F3N5O |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[4-amino-3-[(E)-4,4,4-trifluorobut-2-enimidoyl]phenyl]-5-cyano-3,4-dimethylpyridine-2-carboxamide |
| SMILES | [H]/N=C(\C=C\C(F)(F)F)c1cc(NC(=O)c2ncc(C#N)c(C)c2C)ccc1N |
| InChI | InChI=1S/C19H16F3N5O/c1-10-11(2)17(26-9-12(10)8-23)18(28)27-13-3-4-15(24)14(7-13)16(25)5-6-19(20,21)22/h3-7,9,25H,24H2,1-2H3,(H,27,28)/b6-5+,25-16+ |
| InChIKey | XEJOZHIWNKSXPX-SCJZVMIASA-N |
| XLogP | 3.89 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|