C17H16ClN5O2 — CID 155482359
methyl 2-amino-5-[(6-chloro-5-cyano-3,4-dimethylpyridine-2-carbonyl)amino]benzenecarboximidate (PubChem CID 155482359) has the molecular formula C17H16ClN5O2 and a molecular weight of 357.80 g/mol. Its IUPAC name is methyl 2-amino-5-[(6-chloro-5-cyano-3,4-dimethylpyridine-2-carbonyl)amino]benzenecarboximidate.
| Compound Name | methyl 2-amino-5-[(6-chloro-5-cyano-3,4-dimethylpyridine-2-carbonyl)amino]benzenecarboximidate |
|---|---|
| PubChem CID | 155482359 |
| Molecular Formula | C17H16ClN5O2 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | methyl 2-amino-5-[(6-chloro-5-cyano-3,4-dimethylpyridine-2-carbonyl)amino]benzenecarboximidate |
| SMILES | [H]/N=C(\OC)c1cc(NC(=O)c2nc(Cl)c(C#N)c(C)c2C)ccc1N |
| InChI | InChI=1S/C17H16ClN5O2/c1-8-9(2)14(23-15(18)12(8)7-19)17(24)22-10-4-5-13(20)11(6-10)16(21)25-3/h4-6,21H,20H2,1-3H3,(H,22,24)/b21-16- |
| InChIKey | BSJOOOROGDGSOL-PGMHBOJBSA-N |
| XLogP | 3.03 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|