C22H22ClF2N5O2 — CID 155481957
6-chloro-5-cyano-N-[3-(2,2-difluoroethanimidoyl)-4-(oxan-2-ylamino)phenyl]-3,4-dimethylpyridine-2-carboxamide (PubChem CID 155481957) has the molecular formula C22H22ClF2N5O2 and a molecular weight of 461.90 g/mol. Its IUPAC name is 6-chloro-5-cyano-N-[3-(2,2-difluoroethanimidoyl)-4-(oxan-2-ylamino)phenyl]-3,4-dimethylpyridine-2-carboxamide.
| Compound Name | 6-chloro-5-cyano-N-[3-(2,2-difluoroethanimidoyl)-4-(oxan-2-ylamino)phenyl]-3,4-dimethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 155481957 |
| Molecular Formula | C22H22ClF2N5O2 |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 6-chloro-5-cyano-N-[3-(2,2-difluoroethanimidoyl)-4-(oxan-2-ylamino)phenyl]-3,4-dimethylpyridine-2-carboxamide |
| SMILES | [H]/N=C(/c1cc(NC(=O)c2nc(Cl)c(C#N)c(C)c2C)ccc1NC1CCCCO1)C(F)F |
| InChI | InChI=1S/C22H22ClF2N5O2/c1-11-12(2)19(30-20(23)15(11)10-26)22(31)28-13-6-7-16(14(9-13)18(27)21(24)25)29-17-5-3-4-8-32-17/h6-7,9,17,21,27,29H,3-5,8H2,1-2H3,(H,28,31)/b27-18- |
| InChIKey | OLPHHSJREIJPGG-IMRQLAEWSA-N |
| XLogP | 5.05 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|