C28H31N5O3 — CID 167291080
3-[5-[(1R)-1-(3,5-dimethylpyridazin-4-yl)ethoxy]-2-(oxan-2-ylamino)benzenecarboximidoyl]-5-methoxybenzonitrile (PubChem CID 167291080) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is 3-[5-[(1R)-1-(3,5-dimethylpyridazin-4-yl)ethoxy]-2-(oxan-2-ylamino)benzenecarboximidoyl]-5-methoxybenzonitrile.
| Compound Name | 3-[5-[(1R)-1-(3,5-dimethylpyridazin-4-yl)ethoxy]-2-(oxan-2-ylamino)benzenecarboximidoyl]-5-methoxybenzonitrile |
|---|---|
| PubChem CID | 167291080 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 3-[5-[(1R)-1-(3,5-dimethylpyridazin-4-yl)ethoxy]-2-(oxan-2-ylamino)benzenecarboximidoyl]-5-methoxybenzonitrile |
| SMILES | [H]/N=C(\c1cc(C#N)cc(OC)c1)c1cc(O[C@H](C)c2c(C)cnnc2C)ccc1NC1CCCCO1 |
| InChI | InChI=1S/C28H31N5O3/c1-17-16-31-33-18(2)27(17)19(3)36-22-8-9-25(32-26-7-5-6-10-35-26)24(14-22)28(30)21-11-20(15-29)12-23(13-21)34-4/h8-9,11-14,16,19,26,30,32H,5-7,10H2,1-4H3/b30-28+/t19-,26?/m1/s1 |
| InChIKey | DKMFSOZTPKCWLY-IBVSUCOHSA-N |
| XLogP | 5.47 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|