C22H20FN5O2 — CID 166462525
5-[2-amino-5-[(3,5-dimethylpyridazin-4-yl)methoxy]benzenecarboximidoyl]-3-fluoro-2-methoxybenzonitrile (PubChem CID 166462525) has the molecular formula C22H20FN5O2 and a molecular weight of 405.43 g/mol. Its IUPAC name is 5-[2-amino-5-[(3,5-dimethylpyridazin-4-yl)methoxy]benzenecarboximidoyl]-3-fluoro-2-methoxybenzonitrile.
| Compound Name | 5-[2-amino-5-[(3,5-dimethylpyridazin-4-yl)methoxy]benzenecarboximidoyl]-3-fluoro-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 166462525 |
| Molecular Formula | C22H20FN5O2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 5-[2-amino-5-[(3,5-dimethylpyridazin-4-yl)methoxy]benzenecarboximidoyl]-3-fluoro-2-methoxybenzonitrile |
| SMILES | [H]/N=C(\c1cc(F)c(OC)c(C#N)c1)c1cc(OCc2c(C)cnnc2C)ccc1N |
| InChI | InChI=1S/C22H20FN5O2/c1-12-10-27-28-13(2)18(12)11-30-16-4-5-20(25)17(8-16)21(26)14-6-15(9-24)22(29-3)19(23)7-14/h4-8,10,26H,11,25H2,1-3H3/b26-21+ |
| InChIKey | XAIVMJSYWXOCRI-YYADALCUSA-N |
| XLogP | 3.69 |
| TPSA | 117.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|