C27H31Cl2N5O3 — CID 167291024
4-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(oxan-2-ylamino)benzenecarboximidoyl]-N-(2-methoxyethyl)pyridin-2-amine (PubChem CID 167291024) has the molecular formula C27H31Cl2N5O3 and a molecular weight of 544.48 g/mol. Its IUPAC name is 4-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(oxan-2-ylamino)benzenecarboximidoyl]-N-(2-methoxyethyl)pyridin-2-amine.
| Compound Name | 4-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(oxan-2-ylamino)benzenecarboximidoyl]-N-(2-methoxyethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 167291024 |
| Molecular Formula | C27H31Cl2N5O3 |
| Molecular Weight | 544.48 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 4-[5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(oxan-2-ylamino)benzenecarboximidoyl]-N-(2-methoxyethyl)pyridin-2-amine |
| SMILES | [H]/N=C(\c1ccnc(NCCOC)c1)c1cc(O[C@H](C)c2c(Cl)cncc2Cl)ccc1NC1CCCCO1 |
| InChI | InChI=1S/C27H31Cl2N5O3/c1-17(26-21(28)15-31-16-22(26)29)37-19-6-7-23(34-25-5-3-4-11-36-25)20(14-19)27(30)18-8-9-32-24(13-18)33-10-12-35-2/h6-9,13-17,25,30,34H,3-5,10-12H2,1-2H3,(H,32,33)/b30-27+/t17-,25?/m1/s1 |
| InChIKey | RSQFKHYXDILYMN-SXXDZCONSA-N |
| XLogP | 6.34 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.48 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|