C18H14IN6O3P — CID 155482264
5-cyano-N-[4-(iodophosphanylamino)-3-(2-oxo-1,3-oxazole-3-carboximidoyl)phenyl]-3-methylpyridine-2-carboxamide (PubChem CID 155482264) has the molecular formula C18H14IN6O3P and a molecular weight of 520.23 g/mol. Its IUPAC name is 5-cyano-N-[4-(iodophosphanylamino)-3-(2-oxo-1,3-oxazole-3-carboximidoyl)phenyl]-3-methylpyridine-2-carboxamide.
| Compound Name | 5-cyano-N-[4-(iodophosphanylamino)-3-(2-oxo-1,3-oxazole-3-carboximidoyl)phenyl]-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 155482264 |
| Molecular Formula | C18H14IN6O3P |
| Molecular Weight | 520.23 g/mol |
| Exact Mass | 519.99 |
| IUPAC Name | 5-cyano-N-[4-(iodophosphanylamino)-3-(2-oxo-1,3-oxazole-3-carboximidoyl)phenyl]-3-methylpyridine-2-carboxamide |
| SMILES | [H]/N=C(/c1cc(NC(=O)c2ncc(C#N)cc2C)ccc1NPI)n1ccoc1=O |
| InChI | InChI=1S/C18H14IN6O3P/c1-10-6-11(8-20)9-22-15(10)17(26)23-12-2-3-14(24-29-19)13(7-12)16(21)25-4-5-28-18(25)27/h2-7,9,21,24,29H,1H3,(H,23,26)/b21-16- |
| InChIKey | POMSHQZYUWASMM-PGMHBOJBSA-N |
| XLogP | 3.50 |
| TPSA | 136.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|