C20H17N7O — CID 155482723
N-[4-amino-3-(6-methylpyridazine-4-carboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide (PubChem CID 155482723) has the molecular formula C20H17N7O and a molecular weight of 371.40 g/mol. Its IUPAC name is N-[4-amino-3-(6-methylpyridazine-4-carboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide.
| Compound Name | N-[4-amino-3-(6-methylpyridazine-4-carboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 155482723 |
| Molecular Formula | C20H17N7O |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-[4-amino-3-(6-methylpyridazine-4-carboximidoyl)phenyl]-5-cyano-3-methylpyridine-2-carboxamide |
| SMILES | [H]/N=C(\c1cnnc(C)c1)c1cc(NC(=O)c2ncc(C#N)cc2C)ccc1N |
| InChI | InChI=1S/C20H17N7O/c1-11-5-13(8-21)9-24-19(11)20(28)26-15-3-4-17(22)16(7-15)18(23)14-6-12(2)27-25-10-14/h3-7,9-10,23H,22H2,1-2H3,(H,26,28)/b23-18+ |
| InChIKey | PFYYGWYFWDSZHQ-PTGBLXJZSA-N |
| XLogP | 2.61 |
| TPSA | 141.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|