C11H13BrClN3O — CID 177026996
2-chloro-4-(oxan-2-ylamino)pyridine-3-carboximidoyl bromide (PubChem CID 177026996) has the molecular formula C11H13BrClN3O and a molecular weight of 318.60 g/mol. Its IUPAC name is 2-chloro-4-(oxan-2-ylamino)pyridine-3-carboximidoyl bromide.
| Compound Name | 2-chloro-4-(oxan-2-ylamino)pyridine-3-carboximidoyl bromide |
|---|---|
| PubChem CID | 177026996 |
| Molecular Formula | C11H13BrClN3O |
| Molecular Weight | 318.60 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 2-chloro-4-(oxan-2-ylamino)pyridine-3-carboximidoyl bromide |
| SMILES | [H]/N=C(\Br)c1c(NC2CCCCO2)ccnc1Cl |
| InChI | InChI=1S/C11H13BrClN3O/c12-10(14)9-7(4-5-15-11(9)13)16-8-3-1-2-6-17-8/h4-5,8,14H,1-3,6H2,(H,15,16)/b14-10- |
| InChIKey | YOJKOOJGIAYOFJ-UVTDQMKNSA-N |
| XLogP | 3.39 |
| TPSA | 58.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.60 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|