C14H20N2O2 — CID 70173345
1-N,4-N-bis(oxolan-2-yl)benzene-1,4-diamine (PubChem CID 70173345) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 1-N,4-N-bis(oxolan-2-yl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(oxolan-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 70173345 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 1-N,4-N-bis(oxolan-2-yl)benzene-1,4-diamine |
| SMILES | c1cc(NC2CCCO2)ccc1NC1CCCO1 |
| InChI | InChI=1S/C14H20N2O2/c1-3-13(17-9-1)15-11-5-7-12(8-6-11)16-14-4-2-10-18-14/h5-8,13-16H,1-4,9-10H2 |
| InChIKey | WKDDJXXYBKKZKA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |