C12H16N2O2 — CID 110706685
1-(3-methylphenyl)-3-(oxolan-2-yl)urea (PubChem CID 110706685) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-(oxolan-2-yl)urea.
| Compound Name | 1-(3-methylphenyl)-3-(oxolan-2-yl)urea |
|---|---|
| PubChem CID | 110706685 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-(3-methylphenyl)-3-(oxolan-2-yl)urea |
| SMILES | Cc1cccc(NC(=O)NC2CCCO2)c1 |
| InChI | InChI=1S/C12H16N2O2/c1-9-4-2-5-10(8-9)13-12(15)14-11-6-3-7-16-11/h2,4-5,8,11H,3,6-7H2,1H3,(H2,13,14,15) |
| InChIKey | NVJDXUANSJKSMD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |