C13H18N2O2 — CID 110706691
1-(2,5-dimethylphenyl)-3-(oxolan-2-yl)urea (PubChem CID 110706691) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-(oxolan-2-yl)urea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-(oxolan-2-yl)urea |
|---|---|
| PubChem CID | 110706691 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-(oxolan-2-yl)urea |
| SMILES | Cc1ccc(C)c(NC(=O)NC2CCCO2)c1 |
| InChI | InChI=1S/C13H18N2O2/c1-9-5-6-10(2)11(8-9)14-13(16)15-12-4-3-7-17-12/h5-6,8,12H,3-4,7H2,1-2H3,(H2,14,15,16) |
| InChIKey | ILJWYZUPMAZRIB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |