C18H20N2O — CID 23795651
1-(2,3-dihydro-1H-inden-2-yl)-3-(2,5-dimethylphenyl)urea (PubChem CID 23795651) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-2-yl)-3-(2,5-dimethylphenyl)urea.
| Compound Name | 1-(2,3-dihydro-1H-inden-2-yl)-3-(2,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 23795651 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-2-yl)-3-(2,5-dimethylphenyl)urea |
| SMILES | Cc1ccc(C)c(NC(=O)NC2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C18H20N2O/c1-12-7-8-13(2)17(9-12)20-18(21)19-16-10-14-5-3-4-6-15(14)11-16/h3-9,16H,10-11H2,1-2H3,(H2,19,20,21) |
| InChIKey | VQEKBOCGMMPWAE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |