C17H15N3O — CID 23934831
1-(2-cyanophenyl)-3-(2,3-dihydro-1H-inden-2-yl)urea (PubChem CID 23934831) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-3-(2,3-dihydro-1H-inden-2-yl)urea.
| Compound Name | 1-(2-cyanophenyl)-3-(2,3-dihydro-1H-inden-2-yl)urea |
|---|---|
| PubChem CID | 23934831 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1-(2-cyanophenyl)-3-(2,3-dihydro-1H-inden-2-yl)urea |
| SMILES | N#Cc1ccccc1NC(=O)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H15N3O/c18-11-14-7-3-4-8-16(14)20-17(21)19-15-9-12-5-1-2-6-13(12)10-15/h1-8,15H,9-10H2,(H2,19,20,21) |
| InChIKey | NUGKUYZIXKZRQZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |