C17H14N2O2 — CID 60675908
N-(2-cyanophenyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 60675908) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-(2-cyanophenyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-(2-cyanophenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 60675908 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-(2-cyanophenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)C1COc2ccccc2C1 |
| InChI | InChI=1S/C17H14N2O2/c18-10-13-6-1-3-7-15(13)19-17(20)14-9-12-5-2-4-8-16(12)21-11-14/h1-8,14H,9,11H2,(H,19,20) |
| InChIKey | WWYBJTGAPNUDJV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |