C16H13BrClNO2 — CID 81028513
N-(2-bromo-4-chlorophenyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 81028513) has the molecular formula C16H13BrClNO2 and a molecular weight of 366.64 g/mol. Its IUPAC name is N-(2-bromo-4-chlorophenyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-(2-bromo-4-chlorophenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 81028513 |
| Molecular Formula | C16H13BrClNO2 |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | N-(2-bromo-4-chlorophenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Br)C1COc2ccccc2C1 |
| InChI | InChI=1S/C16H13BrClNO2/c17-13-8-12(18)5-6-14(13)19-16(20)11-7-10-3-1-2-4-15(10)21-9-11/h1-6,8,11H,7,9H2,(H,19,20) |
| InChIKey | OEMTYVLBLRWALJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |