C18H15NO3 — CID 42920781
(2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 42920781) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is (2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate.
| Compound Name | (2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 42920781 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | N#Cc1ccccc1COC(=O)C1COc2ccccc2C1 |
| InChI | InChI=1S/C18H15NO3/c19-10-14-6-1-2-7-15(14)11-22-18(20)16-9-13-5-3-4-8-17(13)21-12-16/h1-8,16H,9,11-12H2 |
| InChIKey | QAMWCQWCBPBDEU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |