(2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate

C18H15NO3 — CID 42920781

IUPAC(2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate
SMILESN#Cc1ccccc1COC(=O)C1COc2ccccc2C1
InChIInChI=1S/C18H15NO3/c19-10-14-6-1-2-7-15(14)11-22-18(20)16-9-13-5-3-4-8-17(13)21-12-16/h1-8,16H,9,11-12H2
InChIKeyQAMWCQWCBPBDEU-UHFFFAOYSA-N
MW293.32 g/mol
LogP2.85
Rot. Bonds3

About (2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate

(2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 42920781) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is (2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate.

Molecular Properties

Compound Name(2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate
PubChem CID42920781
Molecular FormulaC18H15NO3
Molecular Weight293.32 g/mol
Exact Mass293.11
IUPAC Name(2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate
SMILESN#Cc1ccccc1COC(=O)C1COc2ccccc2C1
InChIInChI=1S/C18H15NO3/c19-10-14-6-1-2-7-15(14)11-22-18(20)16-9-13-5-3-4-8-17(13)21-12-16/h1-8,16H,9,11-12H2
InChIKeyQAMWCQWCBPBDEU-UHFFFAOYSA-N
XLogP2.85
TPSA59.32 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.32
LogP ≤ 52.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate?
The IUPAC name of (2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate (CID 42920781) is (2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate.
What is the SMILES notation for (2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate?
The canonical SMILES for (2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate is N#Cc1ccccc1COC(=O)C1COc2ccccc2C1.
What is the InChIKey of (2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate?
The InChIKey is QAMWCQWCBPBDEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO3/c19-10-14-6-1-2-7-15(14)11-22-18(20)16-9-13-5-3-4-8-17(13)21-12-16/h1-8,16H,9,11-12H2.
What are the key properties of (2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate?
(2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate has a molecular weight of 293.32 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanophenyl)methyl 3,4-dihydro-2H-chromene-3-carboxylate is sourced from PubChem (CID 42920781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).