About (2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate
(2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 8647223) has the molecular formula C18H14ClNO3
and a molecular weight of 327.77 g/mol. Its IUPAC name is (2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate.
Molecular Properties
| Compound Name | (2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate |
| PubChem CID | 8647223 |
| Molecular Formula | C18H14ClNO3 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | (2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | N#Cc1ccccc1COC(=O)[C@@H]1COc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C18H14ClNO3/c19-16-5-6-17-14(8-16)7-15(11-22-17)18(21)23-10-13-4-2-1-3-12(13)9-20/h1-6,8,15H,7,10-11H2/t15-/m0/s1 |
| InChIKey | GVRBQJAOKMAKKQ-HNNXBMFYSA-N |
| XLogP | 3.51 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate?
The IUPAC name of (2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate (CID 8647223) is (2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate.
What is the SMILES notation for (2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate?
The canonical SMILES for (2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate is N#Cc1ccccc1COC(=O)[C@@H]1COc2ccc(Cl)cc2C1.
What is the InChIKey of (2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate?
The InChIKey is GVRBQJAOKMAKKQ-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H14ClNO3/c19-16-5-6-17-14(8-16)7-15(11-22-17)18(21)23-10-13-4-2-1-3-12(13)9-20/h1-6,8,15H,7,10-11H2/t15-/m0/s1.
What are the key properties of (2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate?
(2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate has a molecular weight of 327.77 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanophenyl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate is sourced from PubChem (CID 8647223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).