C19H16ClNO5 — CID 55420732
(2-benzamido-2-oxoethyl) 6-chloro-3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 55420732) has the molecular formula C19H16ClNO5 and a molecular weight of 373.79 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 6-chloro-3,4-dihydro-2H-chromene-3-carboxylate.
| Compound Name | (2-benzamido-2-oxoethyl) 6-chloro-3,4-dihydro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 55420732 |
| Molecular Formula | C19H16ClNO5 |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 6-chloro-3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | O=C(COC(=O)C1COc2ccc(Cl)cc2C1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H16ClNO5/c20-15-6-7-16-13(9-15)8-14(10-25-16)19(24)26-11-17(22)21-18(23)12-4-2-1-3-5-12/h1-7,9,14H,8,10-11H2,(H,21,22,23) |
| InChIKey | QSCCLDHWYKVYCE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |