C18H13ClF3NO4 — CID 8641172
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 8641172) has the molecular formula C18H13ClF3NO4 and a molecular weight of 399.75 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 8641172 |
| Molecular Formula | C18H13ClF3NO4 |
| Molecular Weight | 399.75 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1COc2ccc(Cl)cc2C1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H13ClF3NO4/c19-11-1-4-14-9(6-11)5-10(7-26-14)18(25)27-8-15(24)23-13-3-2-12(20)16(21)17(13)22/h1-4,6,10H,5,7-8H2,(H,23,24)/t10-/m0/s1 |
| InChIKey | QQKUAMJXLAESHC-JTQLQIEISA-N |
| XLogP | 3.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|