C17H22O3 — CID 55429666
cyclohexylmethyl 3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 55429666) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is cyclohexylmethyl 3,4-dihydro-2H-chromene-3-carboxylate.
| Compound Name | cyclohexylmethyl 3,4-dihydro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 55429666 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | cyclohexylmethyl 3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | O=C(OCC1CCCCC1)C1COc2ccccc2C1 |
| InChI | InChI=1S/C17H22O3/c18-17(20-11-13-6-2-1-3-7-13)15-10-14-8-4-5-9-16(14)19-12-15/h4-5,8-9,13,15H,1-3,6-7,10-12H2 |
| InChIKey | GVUFKQSGZDEPDK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |