C16H21NO3 — CID 104927114
N-[(1R,2R)-2-hydroxycyclohexyl]-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 104927114) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 104927114 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)C1COc2ccccc2C1 |
| InChI | InChI=1S/C16H21NO3/c18-14-7-3-2-6-13(14)17-16(19)12-9-11-5-1-4-8-15(11)20-10-12/h1,4-5,8,12-14,18H,2-3,6-7,9-10H2,(H,17,19)/t12?,13-,14-/m1/s1 |
| InChIKey | MCBSGPYISBRTHU-ILMHWDKJSA-N |
| XLogP | 1.66 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |