C13H14BrNO2 — CID 113227517
N-(2-bromoprop-2-enyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 113227517) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-(2-bromoprop-2-enyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 113227517 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | C=C(Br)CNC(=O)C1COc2ccccc2C1 |
| InChI | InChI=1S/C13H14BrNO2/c1-9(14)7-15-13(16)11-6-10-4-2-3-5-12(10)17-8-11/h2-5,11H,1,6-8H2,(H,15,16) |
| InChIKey | NYSANUAEXOCEMI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |