C17H16N2O4 — CID 46628945
N-(2-methyl-5-nitrophenyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 46628945) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-(2-methyl-5-nitrophenyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-(2-methyl-5-nitrophenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 46628945 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-(2-methyl-5-nitrophenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)C1COc2ccccc2C1 |
| InChI | InChI=1S/C17H16N2O4/c1-11-6-7-14(19(21)22)9-15(11)18-17(20)13-8-12-4-2-3-5-16(12)23-10-13/h2-7,9,13H,8,10H2,1H3,(H,18,20) |
| InChIKey | PLKREKZUZZYUAS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|