C19H21N3O2 — CID 7513500
1-(2,5-dimethylphenyl)-3-[(3S)-5-oxo-1-phenylpyrrolidin-3-yl]urea (PubChem CID 7513500) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[(3S)-5-oxo-1-phenylpyrrolidin-3-yl]urea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[(3S)-5-oxo-1-phenylpyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 7513500 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[(3S)-5-oxo-1-phenylpyrrolidin-3-yl]urea |
| SMILES | Cc1ccc(C)c(NC(=O)N[C@H]2CC(=O)N(c3ccccc3)C2)c1 |
| InChI | InChI=1S/C19H21N3O2/c1-13-8-9-14(2)17(10-13)21-19(24)20-15-11-18(23)22(12-15)16-6-4-3-5-7-16/h3-10,15H,11-12H2,1-2H3,(H2,20,21,24)/t15-/m0/s1 |
| InChIKey | VDWQBCUPLDQYFL-HNNXBMFYSA-N |
| XLogP | 3.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |