C18H19N3O2 — CID 43969282
1-(4-methylphenyl)-3-(5-oxo-1-phenylpyrrolidin-3-yl)urea (PubChem CID 43969282) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(5-oxo-1-phenylpyrrolidin-3-yl)urea.
| Compound Name | 1-(4-methylphenyl)-3-(5-oxo-1-phenylpyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 43969282 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-(4-methylphenyl)-3-(5-oxo-1-phenylpyrrolidin-3-yl)urea |
| SMILES | Cc1ccc(NC(=O)NC2CC(=O)N(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C18H19N3O2/c1-13-7-9-14(10-8-13)19-18(23)20-15-11-17(22)21(12-15)16-5-3-2-4-6-16/h2-10,15H,11-12H2,1H3,(H2,19,20,23) |
| InChIKey | BFJPRLGWMNSREZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |