C24H24N4O2 — CID 43969485
1-(4-anilinophenyl)-3-[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]urea (PubChem CID 43969485) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-(4-anilinophenyl)-3-[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-(4-anilinophenyl)-3-[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 43969485 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-(4-anilinophenyl)-3-[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]urea |
| SMILES | Cc1ccc(N2CC(NC(=O)Nc3ccc(Nc4ccccc4)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C24H24N4O2/c1-17-7-13-22(14-8-17)28-16-21(15-23(28)29)27-24(30)26-20-11-9-19(10-12-20)25-18-5-3-2-4-6-18/h2-14,21,25H,15-16H2,1H3,(H2,26,27,30) |
| InChIKey | JFINQQTYCWGTTC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |