C25H26N4O2 — CID 43969649
1-(4-anilinophenyl)-3-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]urea (PubChem CID 43969649) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 1-(4-anilinophenyl)-3-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-(4-anilinophenyl)-3-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 43969649 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 1-(4-anilinophenyl)-3-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]urea |
| SMILES | Cc1ccc(N2CC(NC(=O)Nc3ccc(Nc4ccccc4)cc3)CC2=O)cc1C |
| InChI | InChI=1S/C25H26N4O2/c1-17-8-13-23(14-18(17)2)29-16-22(15-24(29)30)28-25(31)27-21-11-9-20(10-12-21)26-19-6-4-3-5-7-19/h3-14,22,26H,15-16H2,1-2H3,(H2,27,28,31) |
| InChIKey | YOBMZMMCJBKVPR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |