C20H22N2O3 — CID 4916607
N-[2-[(2,5-dimethylphenyl)carbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 4916607) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[2-[(2,5-dimethylphenyl)carbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[2-[(2,5-dimethylphenyl)carbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 4916607 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[2-[(2,5-dimethylphenyl)carbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2ccccc2NC(=O)C2CCCO2)c1 |
| InChI | InChI=1S/C20H22N2O3/c1-13-9-10-14(2)17(12-13)22-19(23)15-6-3-4-7-16(15)21-20(24)18-8-5-11-25-18/h3-4,6-7,9-10,12,18H,5,8,11H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | SBWNSRQEGUTZHX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |