C14H18N2O3 — CID 76937440
N-[2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]oxane-2-carboxamide (PubChem CID 76937440) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-[2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]oxane-2-carboxamide.
| Compound Name | N-[2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]oxane-2-carboxamide |
|---|---|
| PubChem CID | 76937440 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-[2-(N-hydroxy-C-methylcarbonimidoyl)phenyl]oxane-2-carboxamide |
| SMILES | CC(=NO)c1ccccc1NC(=O)C1CCCCO1 |
| InChI | InChI=1S/C14H18N2O3/c1-10(16-18)11-6-2-3-7-12(11)15-14(17)13-8-4-5-9-19-13/h2-3,6-7,13,18H,4-5,8-9H2,1H3,(H,15,17) |
| InChIKey | OVKWLRSDNTZLKC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|