C9H9ClN2O2 — CID 162349097
2-chloro-4-(cyclopropylamino)pyridine-3-carboxylic acid (PubChem CID 162349097) has the molecular formula C9H9ClN2O2 and a molecular weight of 212.64 g/mol. Its IUPAC name is 2-chloro-4-(cyclopropylamino)pyridine-3-carboxylic acid.
| Compound Name | 2-chloro-4-(cyclopropylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 162349097 |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 2-chloro-4-(cyclopropylamino)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c(NC2CC2)ccnc1Cl |
| InChI | InChI=1S/C9H9ClN2O2/c10-8-7(9(13)14)6(3-4-11-8)12-5-1-2-5/h3-5H,1-2H2,(H,11,12)(H,13,14) |
| InChIKey | AZRSERNKJYWGAM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|