C14H19FN2O2 — CID 83215411
2-amino-3-fluoro-6-[(4-methylcyclohexyl)amino]benzoic acid (PubChem CID 83215411) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-amino-3-fluoro-6-[(4-methylcyclohexyl)amino]benzoic acid.
| Compound Name | 2-amino-3-fluoro-6-[(4-methylcyclohexyl)amino]benzoic acid |
|---|---|
| PubChem CID | 83215411 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-amino-3-fluoro-6-[(4-methylcyclohexyl)amino]benzoic acid |
| SMILES | CC1CCC(Nc2ccc(F)c(N)c2C(=O)O)CC1 |
| InChI | InChI=1S/C14H19FN2O2/c1-8-2-4-9(5-3-8)17-11-7-6-10(15)13(16)12(11)14(18)19/h6-9,17H,2-5,16H2,1H3,(H,18,19) |
| InChIKey | CMFPNRAAKBOTDE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|