C16H14FN5O — CID 155482666
N-(4-amino-3-fluoro-5-methanimidoylphenyl)-5-cyano-3,4-dimethylpyridine-2-carboxamide (PubChem CID 155482666) has the molecular formula C16H14FN5O and a molecular weight of 311.32 g/mol. Its IUPAC name is N-(4-amino-3-fluoro-5-methanimidoylphenyl)-5-cyano-3,4-dimethylpyridine-2-carboxamide.
| Compound Name | N-(4-amino-3-fluoro-5-methanimidoylphenyl)-5-cyano-3,4-dimethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 155482666 |
| Molecular Formula | C16H14FN5O |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-(4-amino-3-fluoro-5-methanimidoylphenyl)-5-cyano-3,4-dimethylpyridine-2-carboxamide |
| SMILES | [H]/N=C/c1cc(NC(=O)c2ncc(C#N)c(C)c2C)cc(F)c1N |
| InChI | InChI=1S/C16H14FN5O/c1-8-9(2)15(21-7-11(8)6-19)16(23)22-12-3-10(5-18)14(20)13(17)4-12/h3-5,7,18H,20H2,1-2H3,(H,22,23)/b18-5+ |
| InChIKey | UVBYIMWRJMOASO-BLLMUTORSA-N |
| XLogP | 2.54 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|