C22H18F3N3O — CID 164537120
N-[5-methoxy-6-[1-(trifluoromethyl)cyclopropyl]pyridazin-3-yl]-1,1-diphenylmethanimine (PubChem CID 164537120) has the molecular formula C22H18F3N3O and a molecular weight of 397.40 g/mol. Its IUPAC name is N-[5-methoxy-6-[1-(trifluoromethyl)cyclopropyl]pyridazin-3-yl]-1,1-diphenylmethanimine.
| Compound Name | N-[5-methoxy-6-[1-(trifluoromethyl)cyclopropyl]pyridazin-3-yl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 164537120 |
| Molecular Formula | C22H18F3N3O |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[5-methoxy-6-[1-(trifluoromethyl)cyclopropyl]pyridazin-3-yl]-1,1-diphenylmethanimine |
| SMILES | COc1cc(N=C(c2ccccc2)c2ccccc2)nnc1C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H18F3N3O/c1-29-17-14-18(27-28-20(17)21(12-13-21)22(23,24)25)26-19(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,14H,12-13H2,1H3 |
| InChIKey | FOHRTCVMNCKHOU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|