C19H12ClF3N2O — CID 171062917
N-[2-chloro-5-(trifluoromethoxy)-4-pyridinyl]-1,1-diphenylmethanimine (PubChem CID 171062917) has the molecular formula C19H12ClF3N2O and a molecular weight of 376.77 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethoxy)-4-pyridinyl]-1,1-diphenylmethanimine.
| Compound Name | N-[2-chloro-5-(trifluoromethoxy)-4-pyridinyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 171062917 |
| Molecular Formula | C19H12ClF3N2O |
| Molecular Weight | 376.77 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethoxy)-4-pyridinyl]-1,1-diphenylmethanimine |
| SMILES | FC(F)(F)Oc1cnc(Cl)cc1N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H12ClF3N2O/c20-17-11-15(16(12-24-17)26-19(21,22)23)25-18(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H |
| InChIKey | TXAKGKDPIZLABK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.77 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|