C17H13F2N3 — CID 171058853
N-[5-(difluoromethyl)-1H-pyrazol-4-yl]-1,1-diphenylmethanimine (PubChem CID 171058853) has the molecular formula C17H13F2N3 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-[5-(difluoromethyl)-1H-pyrazol-4-yl]-1,1-diphenylmethanimine.
| Compound Name | N-[5-(difluoromethyl)-1H-pyrazol-4-yl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 171058853 |
| Molecular Formula | C17H13F2N3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[5-(difluoromethyl)-1H-pyrazol-4-yl]-1,1-diphenylmethanimine |
| SMILES | FC(F)c1[nH]ncc1N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13F2N3/c18-17(19)16-14(11-20-22-16)21-15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11,17H,(H,20,22) |
| InChIKey | GDIIBRBPIRYSPR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|